C15H20F3NO — CID 62724312
[1-[2-(2,2,2-trifluoroethoxy)ethyl]-3,4-dihydro-2H-naphthalen-1-yl]methanamine (PubChem CID 62724312) has the molecular formula C15H20F3NO and a molecular weight of 287.32 g/mol. Its IUPAC name is [1-[2-(2,2,2-trifluoroethoxy)ethyl]-3,4-dihydro-2H-naphthalen-1-yl]methanamine.
| Compound Name | [1-[2-(2,2,2-trifluoroethoxy)ethyl]-3,4-dihydro-2H-naphthalen-1-yl]methanamine |
|---|---|
| PubChem CID | 62724312 |
| Molecular Formula | C15H20F3NO |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | [1-[2-(2,2,2-trifluoroethoxy)ethyl]-3,4-dihydro-2H-naphthalen-1-yl]methanamine |
| SMILES | NCC1(CCOCC(F)(F)F)CCCc2ccccc21 |
| InChI | InChI=1S/C15H20F3NO/c16-15(17,18)11-20-9-8-14(10-19)7-3-5-12-4-1-2-6-13(12)14/h1-2,4,6H,3,5,7-11,19H2 |
| InChIKey | CADQTENZLLELAI-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|