C17H27NO2S — CID 62724880
2-(1,1-dioxothiolan-3-yl)-2-phenyl-N-propylbutan-1-amine (PubChem CID 62724880) has the molecular formula C17H27NO2S and a molecular weight of 309.48 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-2-phenyl-N-propylbutan-1-amine.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-2-phenyl-N-propylbutan-1-amine |
|---|---|
| PubChem CID | 62724880 |
| Molecular Formula | C17H27NO2S |
| Molecular Weight | 309.48 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-2-phenyl-N-propylbutan-1-amine |
| SMILES | CCCNCC(CC)(c1ccccc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H27NO2S/c1-3-11-18-14-17(4-2,15-8-6-5-7-9-15)16-10-12-21(19,20)13-16/h5-9,16,18H,3-4,10-14H2,1-2H3 |
| InChIKey | NJCCWPLZJUEVKT-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.48 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|