C10H21NO2S — CID 62725297
2-(1,1-dioxothiolan-3-yl)-2-methylpentan-1-amine (PubChem CID 62725297) has the molecular formula C10H21NO2S and a molecular weight of 219.35 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-2-methylpentan-1-amine.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-2-methylpentan-1-amine |
|---|---|
| PubChem CID | 62725297 |
| Molecular Formula | C10H21NO2S |
| Molecular Weight | 219.35 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-2-methylpentan-1-amine |
| SMILES | CCCC(C)(CN)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H21NO2S/c1-3-5-10(2,8-11)9-4-6-14(12,13)7-9/h9H,3-8,11H2,1-2H3 |
| InChIKey | WBSWHUVVFARCEG-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.35 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |