C13H26F3NO — CID 62725545
N-tert-butyl-2,2-dimethyl-5-(2,2,2-trifluoroethoxy)pentan-1-amine (PubChem CID 62725545) has the molecular formula C13H26F3NO and a molecular weight of 269.35 g/mol. Its IUPAC name is N-tert-butyl-2,2-dimethyl-5-(2,2,2-trifluoroethoxy)pentan-1-amine.
| Compound Name | N-tert-butyl-2,2-dimethyl-5-(2,2,2-trifluoroethoxy)pentan-1-amine |
|---|---|
| PubChem CID | 62725545 |
| Molecular Formula | C13H26F3NO |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | N-tert-butyl-2,2-dimethyl-5-(2,2,2-trifluoroethoxy)pentan-1-amine |
| SMILES | CC(C)(CCCOCC(F)(F)F)CNC(C)(C)C |
| InChI | InChI=1S/C13H26F3NO/c1-11(2,3)17-9-12(4,5)7-6-8-18-10-13(14,15)16/h17H,6-10H2,1-5H3 |
| InChIKey | REUIMWJIHZCBPA-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|