About 2-ethyl-2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-N-methylhexan-1-amine
2-ethyl-2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-N-methylhexan-1-amine (PubChem CID 62726242) has the molecular formula C18H32N2O
and a molecular weight of 292.47 g/mol. Its IUPAC name is 2-ethyl-2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-N-methylhexan-1-amine.
Molecular Properties
| Compound Name | 2-ethyl-2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-N-methylhexan-1-amine |
| PubChem CID | 62726242 |
| Molecular Formula | C18H32N2O |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.25 |
| IUPAC Name | 2-ethyl-2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-N-methylhexan-1-amine |
| SMILES | CCCCC(CC)(CNC)Cc1ncc(C)c(OC)c1C |
| InChI | InChI=1S/C18H32N2O/c1-7-9-10-18(8-2,13-19-5)11-16-15(4)17(21-6)14(3)12-20-16/h12,19H,7-11,13H2,1-6H3 |
| InChIKey | BFMLPAUYPJLEAF-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethyl-2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-N-methylhexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-N-methylhexan-1-amine?
The IUPAC name of 2-ethyl-2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-N-methylhexan-1-amine (CID 62726242) is 2-ethyl-2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-N-methylhexan-1-amine.
What is the SMILES notation for 2-ethyl-2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-N-methylhexan-1-amine?
The canonical SMILES for 2-ethyl-2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-N-methylhexan-1-amine is CCCCC(CC)(CNC)Cc1ncc(C)c(OC)c1C.
What is the InChIKey of 2-ethyl-2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-N-methylhexan-1-amine?
The InChIKey is BFMLPAUYPJLEAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32N2O/c1-7-9-10-18(8-2,13-19-5)11-16-15(4)17(21-6)14(3)12-20-16/h12,19H,7-11,13H2,1-6H3.
What are the key properties of 2-ethyl-2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-N-methylhexan-1-amine?
2-ethyl-2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-N-methylhexan-1-amine has a molecular weight of 292.47 g/mol, XLogP of 4.06, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-N-methylhexan-1-amine is sourced from PubChem (CID 62726242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).