C15H24F3NO — CID 62726388
N-[[2-[2-(2,2,2-trifluoroethoxy)ethyl]-2-bicyclo[2.2.1]heptanyl]methyl]cyclopropanamine (PubChem CID 62726388) has the molecular formula C15H24F3NO and a molecular weight of 291.36 g/mol. Its IUPAC name is N-[[2-[2-(2,2,2-trifluoroethoxy)ethyl]-2-bicyclo[2.2.1]heptanyl]methyl]cyclopropanamine.
| Compound Name | N-[[2-[2-(2,2,2-trifluoroethoxy)ethyl]-2-bicyclo[2.2.1]heptanyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 62726388 |
| Molecular Formula | C15H24F3NO |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | N-[[2-[2-(2,2,2-trifluoroethoxy)ethyl]-2-bicyclo[2.2.1]heptanyl]methyl]cyclopropanamine |
| SMILES | FC(F)(F)COCCC1(CNC2CC2)CC2CCC1C2 |
| InChI | InChI=1S/C15H24F3NO/c16-15(17,18)10-20-6-5-14(9-19-13-3-4-13)8-11-1-2-12(14)7-11/h11-13,19H,1-10H2 |
| InChIKey | PRHYMKCQINLGCW-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|