C15H24O7 — CID 627276
ethyl 2-(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecan-6-yl)acetate (PubChem CID 627276) has the molecular formula C15H24O7 and a molecular weight of 316.35 g/mol. Its IUPAC name is ethyl 2-(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecan-6-yl)acetate.
| Compound Name | ethyl 2-(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecan-6-yl)acetate |
|---|---|
| PubChem CID | 627276 |
| Molecular Formula | C15H24O7 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | ethyl 2-(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecan-6-yl)acetate |
| SMILES | CCOC(=O)CC12OC3COC(C)(C)OC3C1OC(C)(C)O2 |
| InChI | InChI=1S/C15H24O7/c1-6-17-10(16)7-15-12(21-14(4,5)22-15)11-9(19-15)8-18-13(2,3)20-11/h9,11-12H,6-8H2,1-5H3 |
| InChIKey | KYRHNESPMTWSMR-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |