C15H19N5S — CID 627279
4-(phenylsulfanylmethyl)-6-piperidin-1-yl-1,3,5-triazin-2-amine (PubChem CID 627279) has the molecular formula C15H19N5S and a molecular weight of 301.42 g/mol. Its IUPAC name is 4-(phenylsulfanylmethyl)-6-piperidin-1-yl-1,3,5-triazin-2-amine.
| Compound Name | 4-(phenylsulfanylmethyl)-6-piperidin-1-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 627279 |
| Molecular Formula | C15H19N5S |
| Molecular Weight | 301.42 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 4-(phenylsulfanylmethyl)-6-piperidin-1-yl-1,3,5-triazin-2-amine |
| SMILES | Nc1nc(CSc2ccccc2)nc(N2CCCCC2)n1 |
| InChI | InChI=1S/C15H19N5S/c16-14-17-13(11-21-12-7-3-1-4-8-12)18-15(19-14)20-9-5-2-6-10-20/h1,3-4,7-8H,2,5-6,9-11H2,(H2,16,17,18,19) |
| InChIKey | YQUSZFGBPBDZGL-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 67.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.42 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |