C11H13ClFNO — CID 62729006
3-chloro-N-(5-fluoro-2-methylphenyl)-2-methylpropanamide (PubChem CID 62729006) has the molecular formula C11H13ClFNO and a molecular weight of 229.68 g/mol. Its IUPAC name is 3-chloro-N-(5-fluoro-2-methylphenyl)-2-methylpropanamide.
| Compound Name | 3-chloro-N-(5-fluoro-2-methylphenyl)-2-methylpropanamide |
|---|---|
| PubChem CID | 62729006 |
| Molecular Formula | C11H13ClFNO |
| Molecular Weight | 229.68 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 3-chloro-N-(5-fluoro-2-methylphenyl)-2-methylpropanamide |
| SMILES | Cc1ccc(F)cc1NC(=O)C(C)CCl |
| InChI | InChI=1S/C11H13ClFNO/c1-7-3-4-9(13)5-10(7)14-11(15)8(2)6-12/h3-5,8H,6H2,1-2H3,(H,14,15) |
| InChIKey | YTOFMHAGABRNQM-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.68 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|