About 6,9-dimethoxy-1,2-dihydro-3-benzoxepin-5-one
6,9-dimethoxy-1,2-dihydro-3-benzoxepin-5-one (PubChem CID 62729703) has the molecular formula C12H14O4
and a molecular weight of 222.24 g/mol. Its IUPAC name is 6,9-dimethoxy-1,2-dihydro-3-benzoxepin-5-one.
Molecular Properties
| Compound Name | 6,9-dimethoxy-1,2-dihydro-3-benzoxepin-5-one |
| PubChem CID | 62729703 |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 6,9-dimethoxy-1,2-dihydro-3-benzoxepin-5-one |
| SMILES | COc1ccc(OC)c2c1CCOCC2=O |
| InChI | InChI=1S/C12H14O4/c1-14-10-3-4-11(15-2)12-8(10)5-6-16-7-9(12)13/h3-4H,5-7H2,1-2H3 |
| InChIKey | UQLCGRUTNDBTLE-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6,9-dimethoxy-1,2-dihydro-3-benzoxepin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,9-dimethoxy-1,2-dihydro-3-benzoxepin-5-one?
The IUPAC name of 6,9-dimethoxy-1,2-dihydro-3-benzoxepin-5-one (CID 62729703) is 6,9-dimethoxy-1,2-dihydro-3-benzoxepin-5-one.
What is the SMILES notation for 6,9-dimethoxy-1,2-dihydro-3-benzoxepin-5-one?
The canonical SMILES for 6,9-dimethoxy-1,2-dihydro-3-benzoxepin-5-one is COc1ccc(OC)c2c1CCOCC2=O.
What is the InChIKey of 6,9-dimethoxy-1,2-dihydro-3-benzoxepin-5-one?
The InChIKey is UQLCGRUTNDBTLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O4/c1-14-10-3-4-11(15-2)12-8(10)5-6-16-7-9(12)13/h3-4H,5-7H2,1-2H3.
What are the key properties of 6,9-dimethoxy-1,2-dihydro-3-benzoxepin-5-one?
6,9-dimethoxy-1,2-dihydro-3-benzoxepin-5-one has a molecular weight of 222.24 g/mol, XLogP of 1.46, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6,9-dimethoxy-1,2-dihydro-3-benzoxepin-5-one is sourced from PubChem (CID 62729703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).