C13H22F3N3O — CID 62730282
1-[3,5-dimethyl-1-[3-(2,2,2-trifluoroethoxy)propyl]pyrazol-4-yl]-N-methylethanamine (PubChem CID 62730282) has the molecular formula C13H22F3N3O and a molecular weight of 293.33 g/mol. Its IUPAC name is 1-[3,5-dimethyl-1-[3-(2,2,2-trifluoroethoxy)propyl]pyrazol-4-yl]-N-methylethanamine.
| Compound Name | 1-[3,5-dimethyl-1-[3-(2,2,2-trifluoroethoxy)propyl]pyrazol-4-yl]-N-methylethanamine |
|---|---|
| PubChem CID | 62730282 |
| Molecular Formula | C13H22F3N3O |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 1-[3,5-dimethyl-1-[3-(2,2,2-trifluoroethoxy)propyl]pyrazol-4-yl]-N-methylethanamine |
| SMILES | CNC(C)c1c(C)nn(CCCOCC(F)(F)F)c1C |
| InChI | InChI=1S/C13H22F3N3O/c1-9(17-4)12-10(2)18-19(11(12)3)6-5-7-20-8-13(14,15)16/h9,17H,5-8H2,1-4H3 |
| InChIKey | VTIKKYWXGCZVAG-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|