About 4-bromo-1-ethoxy-6,7,8,9-tetrahydrobenzo[7]annulen-5-one
4-bromo-1-ethoxy-6,7,8,9-tetrahydrobenzo[7]annulen-5-one (PubChem CID 62732047) has the molecular formula C13H15BrO2
and a molecular weight of 283.17 g/mol. Its IUPAC name is 4-bromo-1-ethoxy-6,7,8,9-tetrahydrobenzo[7]annulen-5-one.
Molecular Properties
| Compound Name | 4-bromo-1-ethoxy-6,7,8,9-tetrahydrobenzo[7]annulen-5-one |
| PubChem CID | 62732047 |
| Molecular Formula | C13H15BrO2 |
| Molecular Weight | 283.17 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | 4-bromo-1-ethoxy-6,7,8,9-tetrahydrobenzo[7]annulen-5-one |
| SMILES | CCOc1ccc(Br)c2c1CCCCC2=O |
| InChI | InChI=1S/C13H15BrO2/c1-2-16-12-8-7-10(14)13-9(12)5-3-4-6-11(13)15/h7-8H,2-6H2,1H3 |
| InChIKey | KXZFCNLKCYEZEK-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.17 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-bromo-1-ethoxy-6,7,8,9-tetrahydrobenzo[7]annulen-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-1-ethoxy-6,7,8,9-tetrahydrobenzo[7]annulen-5-one?
The IUPAC name of 4-bromo-1-ethoxy-6,7,8,9-tetrahydrobenzo[7]annulen-5-one (CID 62732047) is 4-bromo-1-ethoxy-6,7,8,9-tetrahydrobenzo[7]annulen-5-one.
What is the SMILES notation for 4-bromo-1-ethoxy-6,7,8,9-tetrahydrobenzo[7]annulen-5-one?
The canonical SMILES for 4-bromo-1-ethoxy-6,7,8,9-tetrahydrobenzo[7]annulen-5-one is CCOc1ccc(Br)c2c1CCCCC2=O.
What is the InChIKey of 4-bromo-1-ethoxy-6,7,8,9-tetrahydrobenzo[7]annulen-5-one?
The InChIKey is KXZFCNLKCYEZEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15BrO2/c1-2-16-12-8-7-10(14)13-9(12)5-3-4-6-11(13)15/h7-8H,2-6H2,1H3.
What are the key properties of 4-bromo-1-ethoxy-6,7,8,9-tetrahydrobenzo[7]annulen-5-one?
4-bromo-1-ethoxy-6,7,8,9-tetrahydrobenzo[7]annulen-5-one has a molecular weight of 283.17 g/mol, XLogP of 3.76, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-1-ethoxy-6,7,8,9-tetrahydrobenzo[7]annulen-5-one is sourced from PubChem (CID 62732047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).