About 8-bromo-5-ethoxy-3,4-dihydro-2H-naphthalen-1-one
8-bromo-5-ethoxy-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 62732048) has the molecular formula C12H13BrO2
and a molecular weight of 269.14 g/mol. Its IUPAC name is 8-bromo-5-ethoxy-3,4-dihydro-2H-naphthalen-1-one.
Molecular Properties
| Compound Name | 8-bromo-5-ethoxy-3,4-dihydro-2H-naphthalen-1-one |
| PubChem CID | 62732048 |
| Molecular Formula | C12H13BrO2 |
| Molecular Weight | 269.14 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | 8-bromo-5-ethoxy-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | CCOc1ccc(Br)c2c1CCCC2=O |
| InChI | InChI=1S/C12H13BrO2/c1-2-15-11-7-6-9(13)12-8(11)4-3-5-10(12)14/h6-7H,2-5H2,1H3 |
| InChIKey | ZIXWVTDEHYMHDA-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.14 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-bromo-5-ethoxy-3,4-dihydro-2H-naphthalen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-5-ethoxy-3,4-dihydro-2H-naphthalen-1-one?
The IUPAC name of 8-bromo-5-ethoxy-3,4-dihydro-2H-naphthalen-1-one (CID 62732048) is 8-bromo-5-ethoxy-3,4-dihydro-2H-naphthalen-1-one.
What is the SMILES notation for 8-bromo-5-ethoxy-3,4-dihydro-2H-naphthalen-1-one?
The canonical SMILES for 8-bromo-5-ethoxy-3,4-dihydro-2H-naphthalen-1-one is CCOc1ccc(Br)c2c1CCCC2=O.
What is the InChIKey of 8-bromo-5-ethoxy-3,4-dihydro-2H-naphthalen-1-one?
The InChIKey is ZIXWVTDEHYMHDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13BrO2/c1-2-15-11-7-6-9(13)12-8(11)4-3-5-10(12)14/h6-7H,2-5H2,1H3.
What are the key properties of 8-bromo-5-ethoxy-3,4-dihydro-2H-naphthalen-1-one?
8-bromo-5-ethoxy-3,4-dihydro-2H-naphthalen-1-one has a molecular weight of 269.14 g/mol, XLogP of 3.37, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-5-ethoxy-3,4-dihydro-2H-naphthalen-1-one is sourced from PubChem (CID 62732048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).