C15H14N4S — CID 62732646
5-(5-thiophen-2-yl-1H-1,2,4-triazol-3-yl)-1,2,3,4-tetrahydroquinoline (PubChem CID 62732646) has the molecular formula C15H14N4S and a molecular weight of 282.37 g/mol. Its IUPAC name is 5-(5-thiophen-2-yl-1H-1,2,4-triazol-3-yl)-1,2,3,4-tetrahydroquinoline.
| Compound Name | 5-(5-thiophen-2-yl-1H-1,2,4-triazol-3-yl)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 62732646 |
| Molecular Formula | C15H14N4S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 5-(5-thiophen-2-yl-1H-1,2,4-triazol-3-yl)-1,2,3,4-tetrahydroquinoline |
| SMILES | c1csc(-c2nc(-c3cccc4c3CCCN4)n[nH]2)c1 |
| InChI | InChI=1S/C15H14N4S/c1-4-11(10-5-2-8-16-12(10)6-1)14-17-15(19-18-14)13-7-3-9-20-13/h1,3-4,6-7,9,16H,2,5,8H2,(H,17,18,19) |
| InChIKey | PSNDQDUROHXIKT-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |