C12H14N2O2S — CID 62732785
2-methoxy-6-[(1,3-thiazol-4-ylmethylamino)methyl]phenol (PubChem CID 62732785) has the molecular formula C12H14N2O2S and a molecular weight of 250.32 g/mol. Its IUPAC name is 2-methoxy-6-[(1,3-thiazol-4-ylmethylamino)methyl]phenol.
| Compound Name | 2-methoxy-6-[(1,3-thiazol-4-ylmethylamino)methyl]phenol |
|---|---|
| PubChem CID | 62732785 |
| Molecular Formula | C12H14N2O2S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 2-methoxy-6-[(1,3-thiazol-4-ylmethylamino)methyl]phenol |
| SMILES | COc1cccc(CNCc2cscn2)c1O |
| InChI | InChI=1S/C12H14N2O2S/c1-16-11-4-2-3-9(12(11)15)5-13-6-10-7-17-8-14-10/h2-4,7-8,13,15H,5-6H2,1H3 |
| InChIKey | NTDAJSILJNXXEG-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|