C24H42 — CID 627339
1,2,3,4,5,6-hexapropylbenzene (PubChem CID 627339) has the molecular formula C24H42 and a molecular weight of 330.60 g/mol. Its IUPAC name is 1,2,3,4,5,6-hexapropylbenzene.
| Compound Name | 1,2,3,4,5,6-hexapropylbenzene |
|---|---|
| PubChem CID | 627339 |
| Molecular Formula | C24H42 |
| Molecular Weight | 330.60 g/mol |
| Exact Mass | 330.33 |
| IUPAC Name | 1,2,3,4,5,6-hexapropylbenzene |
| SMILES | CCCc1c(CCC)c(CCC)c(CCC)c(CCC)c1CCC |
| InChI | InChI=1S/C24H42/c1-7-13-19-20(14-8-2)22(16-10-4)24(18-12-6)23(17-11-5)21(19)15-9-3/h7-18H2,1-6H3 |
| InChIKey | VKYKQNLHDHRHNN-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.60 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |