C14H17BrFNO — CID 62734387
(2-bromo-4-fluorophenyl)-(2-propan-2-ylpyrrolidin-1-yl)methanone (PubChem CID 62734387) has the molecular formula C14H17BrFNO and a molecular weight of 314.20 g/mol. Its IUPAC name is (2-bromo-4-fluorophenyl)-(2-propan-2-ylpyrrolidin-1-yl)methanone.
| Compound Name | (2-bromo-4-fluorophenyl)-(2-propan-2-ylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 62734387 |
| Molecular Formula | C14H17BrFNO |
| Molecular Weight | 314.20 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | (2-bromo-4-fluorophenyl)-(2-propan-2-ylpyrrolidin-1-yl)methanone |
| SMILES | CC(C)C1CCCN1C(=O)c1ccc(F)cc1Br |
| InChI | InChI=1S/C14H17BrFNO/c1-9(2)13-4-3-7-17(13)14(18)11-6-5-10(16)8-12(11)15/h5-6,8-9,13H,3-4,7H2,1-2H3 |
| InChIKey | IBQNKUVTZUBBFE-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.20 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |