About [(2R)-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrolidin-2-yl]methanol
[(2R)-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrolidin-2-yl]methanol (PubChem CID 62735160) has the molecular formula C9H16F3NO2
and a molecular weight of 227.23 g/mol. Its IUPAC name is [(2R)-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrolidin-2-yl]methanol.
Molecular Properties
| Compound Name | [(2R)-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrolidin-2-yl]methanol |
| PubChem CID | 62735160 |
| Molecular Formula | C9H16F3NO2 |
| Molecular Weight | 227.23 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | [(2R)-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrolidin-2-yl]methanol |
| SMILES | OC[C@H]1CCCN1CCOCC(F)(F)F |
| InChI | InChI=1S/C9H16F3NO2/c10-9(11,12)7-15-5-4-13-3-1-2-8(13)6-14/h8,14H,1-7H2/t8-/m1/s1 |
| InChIKey | SGMGPBOGBITCHZ-MRVPVSSYSA-N |
| XLogP | 1.02 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.23 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrolidin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrolidin-2-yl]methanol?
The IUPAC name of [(2R)-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrolidin-2-yl]methanol (CID 62735160) is [(2R)-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrolidin-2-yl]methanol.
What is the SMILES notation for [(2R)-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrolidin-2-yl]methanol?
The canonical SMILES for [(2R)-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrolidin-2-yl]methanol is OC[C@H]1CCCN1CCOCC(F)(F)F.
What is the InChIKey of [(2R)-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrolidin-2-yl]methanol?
The InChIKey is SGMGPBOGBITCHZ-MRVPVSSYSA-N. The full InChI is InChI=1S/C9H16F3NO2/c10-9(11,12)7-15-5-4-13-3-1-2-8(13)6-14/h8,14H,1-7H2/t8-/m1/s1.
What are the key properties of [(2R)-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrolidin-2-yl]methanol?
[(2R)-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrolidin-2-yl]methanol has a molecular weight of 227.23 g/mol, XLogP of 1.02, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrolidin-2-yl]methanol is sourced from PubChem (CID 62735160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).