About N-butan-2-yl-1,1-dioxothiane-4-sulfonamide
N-butan-2-yl-1,1-dioxothiane-4-sulfonamide (PubChem CID 62735179) has the molecular formula C9H19NO4S2
and a molecular weight of 269.39 g/mol. Its IUPAC name is N-butan-2-yl-1,1-dioxothiane-4-sulfonamide.
Molecular Properties
| Compound Name | N-butan-2-yl-1,1-dioxothiane-4-sulfonamide |
| PubChem CID | 62735179 |
| Molecular Formula | C9H19NO4S2 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | N-butan-2-yl-1,1-dioxothiane-4-sulfonamide |
| SMILES | CCC(C)NS(=O)(=O)C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C9H19NO4S2/c1-3-8(2)10-16(13,14)9-4-6-15(11,12)7-5-9/h8-10H,3-7H2,1-2H3 |
| InChIKey | WXZLGSCXGMPHQG-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-butan-2-yl-1,1-dioxothiane-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butan-2-yl-1,1-dioxothiane-4-sulfonamide?
The IUPAC name of N-butan-2-yl-1,1-dioxothiane-4-sulfonamide (CID 62735179) is N-butan-2-yl-1,1-dioxothiane-4-sulfonamide.
What is the SMILES notation for N-butan-2-yl-1,1-dioxothiane-4-sulfonamide?
The canonical SMILES for N-butan-2-yl-1,1-dioxothiane-4-sulfonamide is CCC(C)NS(=O)(=O)C1CCS(=O)(=O)CC1.
What is the InChIKey of N-butan-2-yl-1,1-dioxothiane-4-sulfonamide?
The InChIKey is WXZLGSCXGMPHQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO4S2/c1-3-8(2)10-16(13,14)9-4-6-15(11,12)7-5-9/h8-10H,3-7H2,1-2H3.
What are the key properties of N-butan-2-yl-1,1-dioxothiane-4-sulfonamide?
N-butan-2-yl-1,1-dioxothiane-4-sulfonamide has a molecular weight of 269.39 g/mol, XLogP of 0.28, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-butan-2-yl-1,1-dioxothiane-4-sulfonamide is sourced from PubChem (CID 62735179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).