C13H17NO2 — CID 62735808
N-methyl-2,3,6,7,8,9-hexahydrobenzo[g][1,4]benzodioxin-6-amine (PubChem CID 62735808) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is N-methyl-2,3,6,7,8,9-hexahydrobenzo[g][1,4]benzodioxin-6-amine.
| Compound Name | N-methyl-2,3,6,7,8,9-hexahydrobenzo[g][1,4]benzodioxin-6-amine |
|---|---|
| PubChem CID | 62735808 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | N-methyl-2,3,6,7,8,9-hexahydrobenzo[g][1,4]benzodioxin-6-amine |
| SMILES | CNC1CCCc2cc3c(cc21)OCCO3 |
| InChI | InChI=1S/C13H17NO2/c1-14-11-4-2-3-9-7-12-13(8-10(9)11)16-6-5-15-12/h7-8,11,14H,2-6H2,1H3 |
| InChIKey | NVEXKDVWTWSZRH-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |