C11H14ClN5 — CID 62737561
N-[[1-(3-chlorophenyl)tetrazol-5-yl]methyl]propan-2-amine (PubChem CID 62737561) has the molecular formula C11H14ClN5 and a molecular weight of 251.72 g/mol. Its IUPAC name is N-[[1-(3-chlorophenyl)tetrazol-5-yl]methyl]propan-2-amine.
| Compound Name | N-[[1-(3-chlorophenyl)tetrazol-5-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 62737561 |
| Molecular Formula | C11H14ClN5 |
| Molecular Weight | 251.72 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | N-[[1-(3-chlorophenyl)tetrazol-5-yl]methyl]propan-2-amine |
| SMILES | CC(C)NCc1nnnn1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C11H14ClN5/c1-8(2)13-7-11-14-15-16-17(11)10-5-3-4-9(12)6-10/h3-6,8,13H,7H2,1-2H3 |
| InChIKey | QZPZXCBEWQDXLD-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.72 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |