C18H14N4O2 — CID 627388
4,7-bis(3-methylphenyl)-3-oxido-[1,2,5]oxadiazolo[3,4-d]pyridazin-3-ium (PubChem CID 627388) has the molecular formula C18H14N4O2 and a molecular weight of 318.34 g/mol. Its IUPAC name is 4,7-bis(3-methylphenyl)-3-oxido-[1,2,5]oxadiazolo[3,4-d]pyridazin-3-ium.
| Compound Name | 4,7-bis(3-methylphenyl)-3-oxido-[1,2,5]oxadiazolo[3,4-d]pyridazin-3-ium |
|---|---|
| PubChem CID | 627388 |
| Molecular Formula | C18H14N4O2 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 4,7-bis(3-methylphenyl)-3-oxido-[1,2,5]oxadiazolo[3,4-d]pyridazin-3-ium |
| SMILES | Cc1cccc(-c2nnc(-c3cccc(C)c3)c3c2no[n+]3[O-])c1 |
| InChI | InChI=1S/C18H14N4O2/c1-11-5-3-7-13(9-11)15-17-18(22(23)24-21-17)16(20-19-15)14-8-4-6-12(2)10-14/h3-10H,1-2H3 |
| InChIKey | MSIJQSIBVATVSY-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 78.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|