2-ethyl-2-methyl-5-(2,2,2-trifluoroethoxy)pentanoic acid

C10H17F3O3 — CID 62740269

IUPAC2-ethyl-2-methyl-5-(2,2,2-trifluoroethoxy)pentanoic acid
SMILESCCC(C)(CCCOCC(F)(F)F)C(=O)O
InChIInChI=1S/C10H17F3O3/c1-3-9(2,8(14)15)5-4-6-16-7-10(11,12)13/h3-7H2,1-2H3,(H,14,15)
InChIKeyNGWWVLCNYGLGQO-UHFFFAOYSA-N
MW242.24 g/mol
LogP2.85
Rot. Bonds7

About 2-ethyl-2-methyl-5-(2,2,2-trifluoroethoxy)pentanoic acid

2-ethyl-2-methyl-5-(2,2,2-trifluoroethoxy)pentanoic acid (PubChem CID 62740269) has the molecular formula C10H17F3O3 and a molecular weight of 242.24 g/mol. Its IUPAC name is 2-ethyl-2-methyl-5-(2,2,2-trifluoroethoxy)pentanoic acid.

Molecular Properties

Compound Name2-ethyl-2-methyl-5-(2,2,2-trifluoroethoxy)pentanoic acid
PubChem CID62740269
Molecular FormulaC10H17F3O3
Molecular Weight242.24 g/mol
Exact Mass242.11
IUPAC Name2-ethyl-2-methyl-5-(2,2,2-trifluoroethoxy)pentanoic acid
SMILESCCC(C)(CCCOCC(F)(F)F)C(=O)O
InChIInChI=1S/C10H17F3O3/c1-3-9(2,8(14)15)5-4-6-16-7-10(11,12)13/h3-7H2,1-2H3,(H,14,15)
InChIKeyNGWWVLCNYGLGQO-UHFFFAOYSA-N
XLogP2.85
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds7
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500242.24
LogP ≤ 52.85
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-ethyl-2-methyl-5-(2,2,2-trifluoroethoxy)pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-ethyl-2-methyl-5-(2,2,2-trifluoroethoxy)pentanoic acid?
The IUPAC name of 2-ethyl-2-methyl-5-(2,2,2-trifluoroethoxy)pentanoic acid (CID 62740269) is 2-ethyl-2-methyl-5-(2,2,2-trifluoroethoxy)pentanoic acid.
What is the SMILES notation for 2-ethyl-2-methyl-5-(2,2,2-trifluoroethoxy)pentanoic acid?
The canonical SMILES for 2-ethyl-2-methyl-5-(2,2,2-trifluoroethoxy)pentanoic acid is CCC(C)(CCCOCC(F)(F)F)C(=O)O.
What is the InChIKey of 2-ethyl-2-methyl-5-(2,2,2-trifluoroethoxy)pentanoic acid?
The InChIKey is NGWWVLCNYGLGQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17F3O3/c1-3-9(2,8(14)15)5-4-6-16-7-10(11,12)13/h3-7H2,1-2H3,(H,14,15).
What are the key properties of 2-ethyl-2-methyl-5-(2,2,2-trifluoroethoxy)pentanoic acid?
2-ethyl-2-methyl-5-(2,2,2-trifluoroethoxy)pentanoic acid has a molecular weight of 242.24 g/mol, XLogP of 2.85, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-2-methyl-5-(2,2,2-trifluoroethoxy)pentanoic acid is sourced from PubChem (CID 62740269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).