About N-(11-acetyl-5,6-dihydrobenzo[b][1]benzazepin-2-yl)ethanesulfonamide
N-(11-acetyl-5,6-dihydrobenzo[b][1]benzazepin-2-yl)ethanesulfonamide (PubChem CID 627403) has the molecular formula C18H20N2O3S
and a molecular weight of 344.44 g/mol. Its IUPAC name is N-(11-acetyl-5,6-dihydrobenzo[b][1]benzazepin-2-yl)ethanesulfonamide.
Molecular Properties
| Compound Name | N-(11-acetyl-5,6-dihydrobenzo[b][1]benzazepin-2-yl)ethanesulfonamide |
| PubChem CID | 627403 |
| Molecular Formula | C18H20N2O3S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | N-(11-acetyl-5,6-dihydrobenzo[b][1]benzazepin-2-yl)ethanesulfonamide |
| SMILES | CCS(=O)(=O)Nc1ccc2c(c1)N(C(C)=O)c1ccccc1CC2 |
| InChI | InChI=1S/C18H20N2O3S/c1-3-24(22,23)19-16-11-10-15-9-8-14-6-4-5-7-17(14)20(13(2)21)18(15)12-16/h4-7,10-12,19H,3,8-9H2,1-2H3 |
| InChIKey | HQBJXMOAFCKOPR-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(11-acetyl-5,6-dihydrobenzo[b][1]benzazepin-2-yl)ethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(11-acetyl-5,6-dihydrobenzo[b][1]benzazepin-2-yl)ethanesulfonamide?
The IUPAC name of N-(11-acetyl-5,6-dihydrobenzo[b][1]benzazepin-2-yl)ethanesulfonamide (CID 627403) is N-(11-acetyl-5,6-dihydrobenzo[b][1]benzazepin-2-yl)ethanesulfonamide.
What is the SMILES notation for N-(11-acetyl-5,6-dihydrobenzo[b][1]benzazepin-2-yl)ethanesulfonamide?
The canonical SMILES for N-(11-acetyl-5,6-dihydrobenzo[b][1]benzazepin-2-yl)ethanesulfonamide is CCS(=O)(=O)Nc1ccc2c(c1)N(C(C)=O)c1ccccc1CC2.
What is the InChIKey of N-(11-acetyl-5,6-dihydrobenzo[b][1]benzazepin-2-yl)ethanesulfonamide?
The InChIKey is HQBJXMOAFCKOPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N2O3S/c1-3-24(22,23)19-16-11-10-15-9-8-14-6-4-5-7-17(14)20(13(2)21)18(15)12-16/h4-7,10-12,19H,3,8-9H2,1-2H3.
What are the key properties of N-(11-acetyl-5,6-dihydrobenzo[b][1]benzazepin-2-yl)ethanesulfonamide?
N-(11-acetyl-5,6-dihydrobenzo[b][1]benzazepin-2-yl)ethanesulfonamide has a molecular weight of 344.44 g/mol, XLogP of 3.23, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(11-acetyl-5,6-dihydrobenzo[b][1]benzazepin-2-yl)ethanesulfonamide is sourced from PubChem (CID 627403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).