C14H14ClN5 — CID 62742484
3-chloro-N-[(5-methyl-1H-imidazol-4-yl)methyl]-2-pyrazol-1-ylaniline (PubChem CID 62742484) has the molecular formula C14H14ClN5 and a molecular weight of 287.75 g/mol. Its IUPAC name is 3-chloro-N-[(5-methyl-1H-imidazol-4-yl)methyl]-2-pyrazol-1-ylaniline.
| Compound Name | 3-chloro-N-[(5-methyl-1H-imidazol-4-yl)methyl]-2-pyrazol-1-ylaniline |
|---|---|
| PubChem CID | 62742484 |
| Molecular Formula | C14H14ClN5 |
| Molecular Weight | 287.75 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 3-chloro-N-[(5-methyl-1H-imidazol-4-yl)methyl]-2-pyrazol-1-ylaniline |
| SMILES | Cc1[nH]cnc1CNc1cccc(Cl)c1-n1cccn1 |
| InChI | InChI=1S/C14H14ClN5/c1-10-13(18-9-17-10)8-16-12-5-2-4-11(15)14(12)20-7-3-6-19-20/h2-7,9,16H,8H2,1H3,(H,17,18) |
| InChIKey | ZHUUMFUHWRNRLM-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.75 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |