About 4-bromo-1-N,1-N-dimethyl-2-N-[(5-methyl-1H-imidazol-4-yl)methyl]benzene-1,2-diamine
4-bromo-1-N,1-N-dimethyl-2-N-[(5-methyl-1H-imidazol-4-yl)methyl]benzene-1,2-diamine (PubChem CID 62742848) has the molecular formula C13H17BrN4
and a molecular weight of 309.21 g/mol. Its IUPAC name is 4-bromo-1-N,1-N-dimethyl-2-N-[(5-methyl-1H-imidazol-4-yl)methyl]benzene-1,2-diamine.
Molecular Properties
| Compound Name | 4-bromo-1-N,1-N-dimethyl-2-N-[(5-methyl-1H-imidazol-4-yl)methyl]benzene-1,2-diamine |
| PubChem CID | 62742848 |
| Molecular Formula | C13H17BrN4 |
| Molecular Weight | 309.21 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 4-bromo-1-N,1-N-dimethyl-2-N-[(5-methyl-1H-imidazol-4-yl)methyl]benzene-1,2-diamine |
| SMILES | Cc1[nH]cnc1CNc1cc(Br)ccc1N(C)C |
| InChI | InChI=1S/C13H17BrN4/c1-9-12(17-8-16-9)7-15-11-6-10(14)4-5-13(11)18(2)3/h4-6,8,15H,7H2,1-3H3,(H,16,17) |
| InChIKey | HHMDQTHANLGADO-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.21 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-bromo-1-N,1-N-dimethyl-2-N-[(5-methyl-1H-imidazol-4-yl)methyl]benzene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-1-N,1-N-dimethyl-2-N-[(5-methyl-1H-imidazol-4-yl)methyl]benzene-1,2-diamine?
The IUPAC name of 4-bromo-1-N,1-N-dimethyl-2-N-[(5-methyl-1H-imidazol-4-yl)methyl]benzene-1,2-diamine (CID 62742848) is 4-bromo-1-N,1-N-dimethyl-2-N-[(5-methyl-1H-imidazol-4-yl)methyl]benzene-1,2-diamine.
What is the SMILES notation for 4-bromo-1-N,1-N-dimethyl-2-N-[(5-methyl-1H-imidazol-4-yl)methyl]benzene-1,2-diamine?
The canonical SMILES for 4-bromo-1-N,1-N-dimethyl-2-N-[(5-methyl-1H-imidazol-4-yl)methyl]benzene-1,2-diamine is Cc1[nH]cnc1CNc1cc(Br)ccc1N(C)C.
What is the InChIKey of 4-bromo-1-N,1-N-dimethyl-2-N-[(5-methyl-1H-imidazol-4-yl)methyl]benzene-1,2-diamine?
The InChIKey is HHMDQTHANLGADO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17BrN4/c1-9-12(17-8-16-9)7-15-11-6-10(14)4-5-13(11)18(2)3/h4-6,8,15H,7H2,1-3H3,(H,16,17).
What are the key properties of 4-bromo-1-N,1-N-dimethyl-2-N-[(5-methyl-1H-imidazol-4-yl)methyl]benzene-1,2-diamine?
4-bromo-1-N,1-N-dimethyl-2-N-[(5-methyl-1H-imidazol-4-yl)methyl]benzene-1,2-diamine has a molecular weight of 309.21 g/mol, XLogP of 3.16, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-1-N,1-N-dimethyl-2-N-[(5-methyl-1H-imidazol-4-yl)methyl]benzene-1,2-diamine is sourced from PubChem (CID 62742848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).