C14H20F3N3 — CID 62744220
N-[3-[4,6-dimethyl-2-(2,2,2-trifluoroethyl)pyrimidin-5-yl]propyl]cyclopropanamine (PubChem CID 62744220) has the molecular formula C14H20F3N3 and a molecular weight of 287.33 g/mol. Its IUPAC name is N-[3-[4,6-dimethyl-2-(2,2,2-trifluoroethyl)pyrimidin-5-yl]propyl]cyclopropanamine.
| Compound Name | N-[3-[4,6-dimethyl-2-(2,2,2-trifluoroethyl)pyrimidin-5-yl]propyl]cyclopropanamine |
|---|---|
| PubChem CID | 62744220 |
| Molecular Formula | C14H20F3N3 |
| Molecular Weight | 287.33 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | N-[3-[4,6-dimethyl-2-(2,2,2-trifluoroethyl)pyrimidin-5-yl]propyl]cyclopropanamine |
| SMILES | Cc1nc(CC(F)(F)F)nc(C)c1CCCNC1CC1 |
| InChI | InChI=1S/C14H20F3N3/c1-9-12(4-3-7-18-11-5-6-11)10(2)20-13(19-9)8-14(15,16)17/h11,18H,3-8H2,1-2H3 |
| InChIKey | GLXNJUJTWDHRMO-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.33 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|