About N-[2-(4,6-dimethyl-2-pyrazin-2-ylpyrimidin-5-yl)ethyl]-2-methylpropan-1-amine
N-[2-(4,6-dimethyl-2-pyrazin-2-ylpyrimidin-5-yl)ethyl]-2-methylpropan-1-amine (PubChem CID 62744430) has the molecular formula C16H23N5
and a molecular weight of 285.39 g/mol. Its IUPAC name is N-[2-(4,6-dimethyl-2-pyrazin-2-ylpyrimidin-5-yl)ethyl]-2-methylpropan-1-amine.
Molecular Properties
| Compound Name | N-[2-(4,6-dimethyl-2-pyrazin-2-ylpyrimidin-5-yl)ethyl]-2-methylpropan-1-amine |
| PubChem CID | 62744430 |
| Molecular Formula | C16H23N5 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.20 |
| IUPAC Name | N-[2-(4,6-dimethyl-2-pyrazin-2-ylpyrimidin-5-yl)ethyl]-2-methylpropan-1-amine |
| SMILES | Cc1nc(-c2cnccn2)nc(C)c1CCNCC(C)C |
| InChI | InChI=1S/C16H23N5/c1-11(2)9-17-6-5-14-12(3)20-16(21-13(14)4)15-10-18-7-8-19-15/h7-8,10-11,17H,5-6,9H2,1-4H3 |
| InChIKey | GRQYXGGZPBXJTR-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(4,6-dimethyl-2-pyrazin-2-ylpyrimidin-5-yl)ethyl]-2-methylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(4,6-dimethyl-2-pyrazin-2-ylpyrimidin-5-yl)ethyl]-2-methylpropan-1-amine?
The IUPAC name of N-[2-(4,6-dimethyl-2-pyrazin-2-ylpyrimidin-5-yl)ethyl]-2-methylpropan-1-amine (CID 62744430) is N-[2-(4,6-dimethyl-2-pyrazin-2-ylpyrimidin-5-yl)ethyl]-2-methylpropan-1-amine.
What is the SMILES notation for N-[2-(4,6-dimethyl-2-pyrazin-2-ylpyrimidin-5-yl)ethyl]-2-methylpropan-1-amine?
The canonical SMILES for N-[2-(4,6-dimethyl-2-pyrazin-2-ylpyrimidin-5-yl)ethyl]-2-methylpropan-1-amine is Cc1nc(-c2cnccn2)nc(C)c1CCNCC(C)C.
What is the InChIKey of N-[2-(4,6-dimethyl-2-pyrazin-2-ylpyrimidin-5-yl)ethyl]-2-methylpropan-1-amine?
The InChIKey is GRQYXGGZPBXJTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N5/c1-11(2)9-17-6-5-14-12(3)20-16(21-13(14)4)15-10-18-7-8-19-15/h7-8,10-11,17H,5-6,9H2,1-4H3.
What are the key properties of N-[2-(4,6-dimethyl-2-pyrazin-2-ylpyrimidin-5-yl)ethyl]-2-methylpropan-1-amine?
N-[2-(4,6-dimethyl-2-pyrazin-2-ylpyrimidin-5-yl)ethyl]-2-methylpropan-1-amine has a molecular weight of 285.39 g/mol, XLogP of 2.34, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(4,6-dimethyl-2-pyrazin-2-ylpyrimidin-5-yl)ethyl]-2-methylpropan-1-amine is sourced from PubChem (CID 62744430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).