About (2-cyclopentyl-4,6-dimethylpyrimidin-5-yl)methanamine
(2-cyclopentyl-4,6-dimethylpyrimidin-5-yl)methanamine (PubChem CID 62744554) has the molecular formula C12H19N3
and a molecular weight of 205.30 g/mol. Its IUPAC name is (2-cyclopentyl-4,6-dimethylpyrimidin-5-yl)methanamine.
Molecular Properties
| Compound Name | (2-cyclopentyl-4,6-dimethylpyrimidin-5-yl)methanamine |
| PubChem CID | 62744554 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | (2-cyclopentyl-4,6-dimethylpyrimidin-5-yl)methanamine |
| SMILES | Cc1nc(C2CCCC2)nc(C)c1CN |
| InChI | InChI=1S/C12H19N3/c1-8-11(7-13)9(2)15-12(14-8)10-5-3-4-6-10/h10H,3-7,13H2,1-2H3 |
| InChIKey | RZYJMZYGOWUFBJ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-cyclopentyl-4,6-dimethylpyrimidin-5-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-cyclopentyl-4,6-dimethylpyrimidin-5-yl)methanamine?
The IUPAC name of (2-cyclopentyl-4,6-dimethylpyrimidin-5-yl)methanamine (CID 62744554) is (2-cyclopentyl-4,6-dimethylpyrimidin-5-yl)methanamine.
What is the SMILES notation for (2-cyclopentyl-4,6-dimethylpyrimidin-5-yl)methanamine?
The canonical SMILES for (2-cyclopentyl-4,6-dimethylpyrimidin-5-yl)methanamine is Cc1nc(C2CCCC2)nc(C)c1CN.
What is the InChIKey of (2-cyclopentyl-4,6-dimethylpyrimidin-5-yl)methanamine?
The InChIKey is RZYJMZYGOWUFBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3/c1-8-11(7-13)9(2)15-12(14-8)10-5-3-4-6-10/h10H,3-7,13H2,1-2H3.
What are the key properties of (2-cyclopentyl-4,6-dimethylpyrimidin-5-yl)methanamine?
(2-cyclopentyl-4,6-dimethylpyrimidin-5-yl)methanamine has a molecular weight of 205.30 g/mol, XLogP of 2.21, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-cyclopentyl-4,6-dimethylpyrimidin-5-yl)methanamine is sourced from PubChem (CID 62744554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).