About N-[3-[4,6-dimethyl-2-(methylsulfonylmethyl)pyrimidin-5-yl]propyl]-2-methylpropan-1-amine
N-[3-[4,6-dimethyl-2-(methylsulfonylmethyl)pyrimidin-5-yl]propyl]-2-methylpropan-1-amine (PubChem CID 62745801) has the molecular formula C15H27N3O2S
and a molecular weight of 313.47 g/mol. Its IUPAC name is N-[3-[4,6-dimethyl-2-(methylsulfonylmethyl)pyrimidin-5-yl]propyl]-2-methylpropan-1-amine.
Molecular Properties
| Compound Name | N-[3-[4,6-dimethyl-2-(methylsulfonylmethyl)pyrimidin-5-yl]propyl]-2-methylpropan-1-amine |
| PubChem CID | 62745801 |
| Molecular Formula | C15H27N3O2S |
| Molecular Weight | 313.47 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | N-[3-[4,6-dimethyl-2-(methylsulfonylmethyl)pyrimidin-5-yl]propyl]-2-methylpropan-1-amine |
| SMILES | Cc1nc(CS(C)(=O)=O)nc(C)c1CCCNCC(C)C |
| InChI | InChI=1S/C15H27N3O2S/c1-11(2)9-16-8-6-7-14-12(3)17-15(18-13(14)4)10-21(5,19)20/h11,16H,6-10H2,1-5H3 |
| InChIKey | SMDVOYYECFZTTA-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.47 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[3-[4,6-dimethyl-2-(methylsulfonylmethyl)pyrimidin-5-yl]propyl]-2-methylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[4,6-dimethyl-2-(methylsulfonylmethyl)pyrimidin-5-yl]propyl]-2-methylpropan-1-amine?
The IUPAC name of N-[3-[4,6-dimethyl-2-(methylsulfonylmethyl)pyrimidin-5-yl]propyl]-2-methylpropan-1-amine (CID 62745801) is N-[3-[4,6-dimethyl-2-(methylsulfonylmethyl)pyrimidin-5-yl]propyl]-2-methylpropan-1-amine.
What is the SMILES notation for N-[3-[4,6-dimethyl-2-(methylsulfonylmethyl)pyrimidin-5-yl]propyl]-2-methylpropan-1-amine?
The canonical SMILES for N-[3-[4,6-dimethyl-2-(methylsulfonylmethyl)pyrimidin-5-yl]propyl]-2-methylpropan-1-amine is Cc1nc(CS(C)(=O)=O)nc(C)c1CCCNCC(C)C.
What is the InChIKey of N-[3-[4,6-dimethyl-2-(methylsulfonylmethyl)pyrimidin-5-yl]propyl]-2-methylpropan-1-amine?
The InChIKey is SMDVOYYECFZTTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27N3O2S/c1-11(2)9-16-8-6-7-14-12(3)17-15(18-13(14)4)10-21(5,19)20/h11,16H,6-10H2,1-5H3.
What are the key properties of N-[3-[4,6-dimethyl-2-(methylsulfonylmethyl)pyrimidin-5-yl]propyl]-2-methylpropan-1-amine?
N-[3-[4,6-dimethyl-2-(methylsulfonylmethyl)pyrimidin-5-yl]propyl]-2-methylpropan-1-amine has a molecular weight of 313.47 g/mol, XLogP of 1.82, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[4,6-dimethyl-2-(methylsulfonylmethyl)pyrimidin-5-yl]propyl]-2-methylpropan-1-amine is sourced from PubChem (CID 62745801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).