About 2-[2-(3,4-difluorophenyl)-4,6-dimethylpyrimidin-5-yl]propan-1-amine
2-[2-(3,4-difluorophenyl)-4,6-dimethylpyrimidin-5-yl]propan-1-amine (PubChem CID 62745958) has the molecular formula C15H17F2N3
and a molecular weight of 277.32 g/mol. Its IUPAC name is 2-[2-(3,4-difluorophenyl)-4,6-dimethylpyrimidin-5-yl]propan-1-amine.
Molecular Properties
| Compound Name | 2-[2-(3,4-difluorophenyl)-4,6-dimethylpyrimidin-5-yl]propan-1-amine |
| PubChem CID | 62745958 |
| Molecular Formula | C15H17F2N3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | 2-[2-(3,4-difluorophenyl)-4,6-dimethylpyrimidin-5-yl]propan-1-amine |
| SMILES | Cc1nc(-c2ccc(F)c(F)c2)nc(C)c1C(C)CN |
| InChI | InChI=1S/C15H17F2N3/c1-8(7-18)14-9(2)19-15(20-10(14)3)11-4-5-12(16)13(17)6-11/h4-6,8H,7,18H2,1-3H3 |
| InChIKey | IJTHVLLBRHHBGI-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[2-(3,4-difluorophenyl)-4,6-dimethylpyrimidin-5-yl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(3,4-difluorophenyl)-4,6-dimethylpyrimidin-5-yl]propan-1-amine?
The IUPAC name of 2-[2-(3,4-difluorophenyl)-4,6-dimethylpyrimidin-5-yl]propan-1-amine (CID 62745958) is 2-[2-(3,4-difluorophenyl)-4,6-dimethylpyrimidin-5-yl]propan-1-amine.
What is the SMILES notation for 2-[2-(3,4-difluorophenyl)-4,6-dimethylpyrimidin-5-yl]propan-1-amine?
The canonical SMILES for 2-[2-(3,4-difluorophenyl)-4,6-dimethylpyrimidin-5-yl]propan-1-amine is Cc1nc(-c2ccc(F)c(F)c2)nc(C)c1C(C)CN.
What is the InChIKey of 2-[2-(3,4-difluorophenyl)-4,6-dimethylpyrimidin-5-yl]propan-1-amine?
The InChIKey is IJTHVLLBRHHBGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17F2N3/c1-8(7-18)14-9(2)19-15(20-10(14)3)11-4-5-12(16)13(17)6-11/h4-6,8H,7,18H2,1-3H3.
What are the key properties of 2-[2-(3,4-difluorophenyl)-4,6-dimethylpyrimidin-5-yl]propan-1-amine?
2-[2-(3,4-difluorophenyl)-4,6-dimethylpyrimidin-5-yl]propan-1-amine has a molecular weight of 277.32 g/mol, XLogP of 3.10, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(3,4-difluorophenyl)-4,6-dimethylpyrimidin-5-yl]propan-1-amine is sourced from PubChem (CID 62745958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).