About N-[[2-(2-bromophenyl)-4,6-dimethylpyrimidin-5-yl]methyl]propan-2-amine
N-[[2-(2-bromophenyl)-4,6-dimethylpyrimidin-5-yl]methyl]propan-2-amine (PubChem CID 62746192) has the molecular formula C16H20BrN3
and a molecular weight of 334.26 g/mol. Its IUPAC name is N-[[2-(2-bromophenyl)-4,6-dimethylpyrimidin-5-yl]methyl]propan-2-amine.
Molecular Properties
| Compound Name | N-[[2-(2-bromophenyl)-4,6-dimethylpyrimidin-5-yl]methyl]propan-2-amine |
| PubChem CID | 62746192 |
| Molecular Formula | C16H20BrN3 |
| Molecular Weight | 334.26 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | N-[[2-(2-bromophenyl)-4,6-dimethylpyrimidin-5-yl]methyl]propan-2-amine |
| SMILES | Cc1nc(-c2ccccc2Br)nc(C)c1CNC(C)C |
| InChI | InChI=1S/C16H20BrN3/c1-10(2)18-9-14-11(3)19-16(20-12(14)4)13-7-5-6-8-15(13)17/h5-8,10,18H,9H2,1-4H3 |
| InChIKey | DGYWQSGXYPBJQX-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.26 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[[2-(2-bromophenyl)-4,6-dimethylpyrimidin-5-yl]methyl]propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[2-(2-bromophenyl)-4,6-dimethylpyrimidin-5-yl]methyl]propan-2-amine?
The IUPAC name of N-[[2-(2-bromophenyl)-4,6-dimethylpyrimidin-5-yl]methyl]propan-2-amine (CID 62746192) is N-[[2-(2-bromophenyl)-4,6-dimethylpyrimidin-5-yl]methyl]propan-2-amine.
What is the SMILES notation for N-[[2-(2-bromophenyl)-4,6-dimethylpyrimidin-5-yl]methyl]propan-2-amine?
The canonical SMILES for N-[[2-(2-bromophenyl)-4,6-dimethylpyrimidin-5-yl]methyl]propan-2-amine is Cc1nc(-c2ccccc2Br)nc(C)c1CNC(C)C.
What is the InChIKey of N-[[2-(2-bromophenyl)-4,6-dimethylpyrimidin-5-yl]methyl]propan-2-amine?
The InChIKey is DGYWQSGXYPBJQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20BrN3/c1-10(2)18-9-14-11(3)19-16(20-12(14)4)13-7-5-6-8-15(13)17/h5-8,10,18H,9H2,1-4H3.
What are the key properties of N-[[2-(2-bromophenyl)-4,6-dimethylpyrimidin-5-yl]methyl]propan-2-amine?
N-[[2-(2-bromophenyl)-4,6-dimethylpyrimidin-5-yl]methyl]propan-2-amine has a molecular weight of 334.26 g/mol, XLogP of 4.02, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[2-(2-bromophenyl)-4,6-dimethylpyrimidin-5-yl]methyl]propan-2-amine is sourced from PubChem (CID 62746192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).