About [2-(3,5-difluorophenyl)pyrimidin-4-yl]methanol
[2-(3,5-difluorophenyl)pyrimidin-4-yl]methanol (PubChem CID 62749028) has the molecular formula C11H8F2N2O
and a molecular weight of 222.19 g/mol. Its IUPAC name is [2-(3,5-difluorophenyl)pyrimidin-4-yl]methanol.
Molecular Properties
| Compound Name | [2-(3,5-difluorophenyl)pyrimidin-4-yl]methanol |
| PubChem CID | 62749028 |
| Molecular Formula | C11H8F2N2O |
| Molecular Weight | 222.19 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | [2-(3,5-difluorophenyl)pyrimidin-4-yl]methanol |
| SMILES | OCc1ccnc(-c2cc(F)cc(F)c2)n1 |
| InChI | InChI=1S/C11H8F2N2O/c12-8-3-7(4-9(13)5-8)11-14-2-1-10(6-16)15-11/h1-5,16H,6H2 |
| InChIKey | AVYNYBDOFHFQQM-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.19 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-(3,5-difluorophenyl)pyrimidin-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3,5-difluorophenyl)pyrimidin-4-yl]methanol?
The IUPAC name of [2-(3,5-difluorophenyl)pyrimidin-4-yl]methanol (CID 62749028) is [2-(3,5-difluorophenyl)pyrimidin-4-yl]methanol.
What is the SMILES notation for [2-(3,5-difluorophenyl)pyrimidin-4-yl]methanol?
The canonical SMILES for [2-(3,5-difluorophenyl)pyrimidin-4-yl]methanol is OCc1ccnc(-c2cc(F)cc(F)c2)n1.
What is the InChIKey of [2-(3,5-difluorophenyl)pyrimidin-4-yl]methanol?
The InChIKey is AVYNYBDOFHFQQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8F2N2O/c12-8-3-7(4-9(13)5-8)11-14-2-1-10(6-16)15-11/h1-5,16H,6H2.
What are the key properties of [2-(3,5-difluorophenyl)pyrimidin-4-yl]methanol?
[2-(3,5-difluorophenyl)pyrimidin-4-yl]methanol has a molecular weight of 222.19 g/mol, XLogP of 1.91, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3,5-difluorophenyl)pyrimidin-4-yl]methanol is sourced from PubChem (CID 62749028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).