C13H20F3N3S — CID 62750008
2-N-ethyl-5,5-dimethyl-2-N-(2,2,2-trifluoroethyl)-6,7-dihydro-4H-1,3-benzothiazole-2,7-diamine (PubChem CID 62750008) has the molecular formula C13H20F3N3S and a molecular weight of 307.39 g/mol. Its IUPAC name is 2-N-ethyl-5,5-dimethyl-2-N-(2,2,2-trifluoroethyl)-6,7-dihydro-4H-1,3-benzothiazole-2,7-diamine.
| Compound Name | 2-N-ethyl-5,5-dimethyl-2-N-(2,2,2-trifluoroethyl)-6,7-dihydro-4H-1,3-benzothiazole-2,7-diamine |
|---|---|
| PubChem CID | 62750008 |
| Molecular Formula | C13H20F3N3S |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 2-N-ethyl-5,5-dimethyl-2-N-(2,2,2-trifluoroethyl)-6,7-dihydro-4H-1,3-benzothiazole-2,7-diamine |
| SMILES | CCN(CC(F)(F)F)c1nc2c(s1)C(N)CC(C)(C)C2 |
| InChI | InChI=1S/C13H20F3N3S/c1-4-19(7-13(14,15)16)11-18-9-6-12(2,3)5-8(17)10(9)20-11/h8H,4-7,17H2,1-3H3 |
| InChIKey | QEPIMHCNMRWERT-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |