C14H22F3N3S — CID 62750610
7-N-ethyl-2-N,5,5-trimethyl-2-N-(2,2,2-trifluoroethyl)-6,7-dihydro-4H-1,3-benzothiazole-2,7-diamine (PubChem CID 62750610) has the molecular formula C14H22F3N3S and a molecular weight of 321.41 g/mol. Its IUPAC name is 7-N-ethyl-2-N,5,5-trimethyl-2-N-(2,2,2-trifluoroethyl)-6,7-dihydro-4H-1,3-benzothiazole-2,7-diamine.
| Compound Name | 7-N-ethyl-2-N,5,5-trimethyl-2-N-(2,2,2-trifluoroethyl)-6,7-dihydro-4H-1,3-benzothiazole-2,7-diamine |
|---|---|
| PubChem CID | 62750610 |
| Molecular Formula | C14H22F3N3S |
| Molecular Weight | 321.41 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 7-N-ethyl-2-N,5,5-trimethyl-2-N-(2,2,2-trifluoroethyl)-6,7-dihydro-4H-1,3-benzothiazole-2,7-diamine |
| SMILES | CCNC1CC(C)(C)Cc2nc(N(C)CC(F)(F)F)sc21 |
| InChI | InChI=1S/C14H22F3N3S/c1-5-18-9-6-13(2,3)7-10-11(9)21-12(19-10)20(4)8-14(15,16)17/h9,18H,5-8H2,1-4H3 |
| InChIKey | QGWRIEYAZVMIIN-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.41 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |