C12H18F3N3S — CID 62750618
7-N-ethyl-2-N-methyl-2-N-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,7-diamine (PubChem CID 62750618) has the molecular formula C12H18F3N3S and a molecular weight of 293.36 g/mol. Its IUPAC name is 7-N-ethyl-2-N-methyl-2-N-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,7-diamine.
| Compound Name | 7-N-ethyl-2-N-methyl-2-N-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,7-diamine |
|---|---|
| PubChem CID | 62750618 |
| Molecular Formula | C12H18F3N3S |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 7-N-ethyl-2-N-methyl-2-N-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,7-diamine |
| SMILES | CCNC1CCCc2nc(N(C)CC(F)(F)F)sc21 |
| InChI | InChI=1S/C12H18F3N3S/c1-3-16-8-5-4-6-9-10(8)19-11(17-9)18(2)7-12(13,14)15/h8,16H,3-7H2,1-2H3 |
| InChIKey | FGPKHMPBAVFACQ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |