C13H20F3N3S — CID 62750619
2-N-methyl-7-N-propyl-2-N-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,7-diamine (PubChem CID 62750619) has the molecular formula C13H20F3N3S and a molecular weight of 307.39 g/mol. Its IUPAC name is 2-N-methyl-7-N-propyl-2-N-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,7-diamine.
| Compound Name | 2-N-methyl-7-N-propyl-2-N-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,7-diamine |
|---|---|
| PubChem CID | 62750619 |
| Molecular Formula | C13H20F3N3S |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 2-N-methyl-7-N-propyl-2-N-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,7-diamine |
| SMILES | CCCNC1CCCc2nc(N(C)CC(F)(F)F)sc21 |
| InChI | InChI=1S/C13H20F3N3S/c1-3-7-17-9-5-4-6-10-11(9)20-12(18-10)19(2)8-13(14,15)16/h9,17H,3-8H2,1-2H3 |
| InChIKey | AWTMBGKIJWETLE-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |