C12H11FN2OS — CID 62751151
1-[2-(2-fluoro-N-methylanilino)-1,3-thiazol-5-yl]ethanone (PubChem CID 62751151) has the molecular formula C12H11FN2OS and a molecular weight of 250.30 g/mol. Its IUPAC name is 1-[2-(2-fluoro-N-methylanilino)-1,3-thiazol-5-yl]ethanone.
| Compound Name | 1-[2-(2-fluoro-N-methylanilino)-1,3-thiazol-5-yl]ethanone |
|---|---|
| PubChem CID | 62751151 |
| Molecular Formula | C12H11FN2OS |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 1-[2-(2-fluoro-N-methylanilino)-1,3-thiazol-5-yl]ethanone |
| SMILES | CC(=O)c1cnc(N(C)c2ccccc2F)s1 |
| InChI | InChI=1S/C12H11FN2OS/c1-8(16)11-7-14-12(17-11)15(2)10-6-4-3-5-9(10)13/h3-7H,1-2H3 |
| InChIKey | WAOVUCRBCLBEOW-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |