About 1-[2-(azepan-1-yl)-1,3-thiazol-5-yl]-N-methylmethanamine
1-[2-(azepan-1-yl)-1,3-thiazol-5-yl]-N-methylmethanamine (PubChem CID 62751244) has the molecular formula C11H19N3S
and a molecular weight of 225.36 g/mol. Its IUPAC name is 1-[2-(azepan-1-yl)-1,3-thiazol-5-yl]-N-methylmethanamine.
Molecular Properties
| Compound Name | 1-[2-(azepan-1-yl)-1,3-thiazol-5-yl]-N-methylmethanamine |
| PubChem CID | 62751244 |
| Molecular Formula | C11H19N3S |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 1-[2-(azepan-1-yl)-1,3-thiazol-5-yl]-N-methylmethanamine |
| SMILES | CNCc1cnc(N2CCCCCC2)s1 |
| InChI | InChI=1S/C11H19N3S/c1-12-8-10-9-13-11(15-10)14-6-4-2-3-5-7-14/h9,12H,2-8H2,1H3 |
| InChIKey | HSEBLNQBUPFBKL-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[2-(azepan-1-yl)-1,3-thiazol-5-yl]-N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(azepan-1-yl)-1,3-thiazol-5-yl]-N-methylmethanamine?
The IUPAC name of 1-[2-(azepan-1-yl)-1,3-thiazol-5-yl]-N-methylmethanamine (CID 62751244) is 1-[2-(azepan-1-yl)-1,3-thiazol-5-yl]-N-methylmethanamine.
What is the SMILES notation for 1-[2-(azepan-1-yl)-1,3-thiazol-5-yl]-N-methylmethanamine?
The canonical SMILES for 1-[2-(azepan-1-yl)-1,3-thiazol-5-yl]-N-methylmethanamine is CNCc1cnc(N2CCCCCC2)s1.
What is the InChIKey of 1-[2-(azepan-1-yl)-1,3-thiazol-5-yl]-N-methylmethanamine?
The InChIKey is HSEBLNQBUPFBKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3S/c1-12-8-10-9-13-11(15-10)14-6-4-2-3-5-7-14/h9,12H,2-8H2,1H3.
What are the key properties of 1-[2-(azepan-1-yl)-1,3-thiazol-5-yl]-N-methylmethanamine?
1-[2-(azepan-1-yl)-1,3-thiazol-5-yl]-N-methylmethanamine has a molecular weight of 225.36 g/mol, XLogP of 2.24, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(azepan-1-yl)-1,3-thiazol-5-yl]-N-methylmethanamine is sourced from PubChem (CID 62751244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).