C12H20N2OS — CID 62752785
1-[2-(azepan-1-yl)-4-methyl-1,3-thiazol-5-yl]ethanol (PubChem CID 62752785) has the molecular formula C12H20N2OS and a molecular weight of 240.37 g/mol. Its IUPAC name is 1-[2-(azepan-1-yl)-4-methyl-1,3-thiazol-5-yl]ethanol.
| Compound Name | 1-[2-(azepan-1-yl)-4-methyl-1,3-thiazol-5-yl]ethanol |
|---|---|
| PubChem CID | 62752785 |
| Molecular Formula | C12H20N2OS |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 1-[2-(azepan-1-yl)-4-methyl-1,3-thiazol-5-yl]ethanol |
| SMILES | Cc1nc(N2CCCCCC2)sc1C(C)O |
| InChI | InChI=1S/C12H20N2OS/c1-9-11(10(2)15)16-12(13-9)14-7-5-3-4-6-8-14/h10,15H,3-8H2,1-2H3 |
| InChIKey | CAJWOLIVUOAEJY-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |