C14H22F3N3S — CID 62752859
2-N-ethyl-7-N-propyl-2-N-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,7-diamine (PubChem CID 62752859) has the molecular formula C14H22F3N3S and a molecular weight of 321.41 g/mol. Its IUPAC name is 2-N-ethyl-7-N-propyl-2-N-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,7-diamine.
| Compound Name | 2-N-ethyl-7-N-propyl-2-N-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,7-diamine |
|---|---|
| PubChem CID | 62752859 |
| Molecular Formula | C14H22F3N3S |
| Molecular Weight | 321.41 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 2-N-ethyl-7-N-propyl-2-N-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,7-diamine |
| SMILES | CCCNC1CCCc2nc(N(CC)CC(F)(F)F)sc21 |
| InChI | InChI=1S/C14H22F3N3S/c1-3-8-18-10-6-5-7-11-12(10)21-13(19-11)20(4-2)9-14(15,16)17/h10,18H,3-9H2,1-2H3 |
| InChIKey | VDIDNMIOROMEJI-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.41 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |