C12H17F3N2OS — CID 62753179
2-[propan-2-yl(2,2,2-trifluoroethyl)amino]-4,5,6,7-tetrahydro-1,3-benzothiazol-7-ol (PubChem CID 62753179) has the molecular formula C12H17F3N2OS and a molecular weight of 294.34 g/mol. Its IUPAC name is 2-[propan-2-yl(2,2,2-trifluoroethyl)amino]-4,5,6,7-tetrahydro-1,3-benzothiazol-7-ol.
| Compound Name | 2-[propan-2-yl(2,2,2-trifluoroethyl)amino]-4,5,6,7-tetrahydro-1,3-benzothiazol-7-ol |
|---|---|
| PubChem CID | 62753179 |
| Molecular Formula | C12H17F3N2OS |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 2-[propan-2-yl(2,2,2-trifluoroethyl)amino]-4,5,6,7-tetrahydro-1,3-benzothiazol-7-ol |
| SMILES | CC(C)N(CC(F)(F)F)c1nc2c(s1)C(O)CCC2 |
| InChI | InChI=1S/C12H17F3N2OS/c1-7(2)17(6-12(13,14)15)11-16-8-4-3-5-9(18)10(8)19-11/h7,9,18H,3-6H2,1-2H3 |
| InChIKey | XQKZXXRJOKCJBF-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |