About 2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-1,3-thiazole-5-carboxylic acid
2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-1,3-thiazole-5-carboxylic acid (PubChem CID 62753297) has the molecular formula C11H12N4O2S2
and a molecular weight of 296.38 g/mol. Its IUPAC name is 2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-1,3-thiazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-1,3-thiazole-5-carboxylic acid |
| PubChem CID | 62753297 |
| Molecular Formula | C11H12N4O2S2 |
| Molecular Weight | 296.38 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-1,3-thiazole-5-carboxylic acid |
| SMILES | O=C(O)c1cnc(N2CCN(c3nccs3)CC2)s1 |
| InChI | InChI=1S/C11H12N4O2S2/c16-9(17)8-7-13-11(19-8)15-4-2-14(3-5-15)10-12-1-6-18-10/h1,6-7H,2-5H2,(H,16,17) |
| InChIKey | YYFKAISYCMQSLN-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.38 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-1,3-thiazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-1,3-thiazole-5-carboxylic acid (CID 62753297) is 2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-1,3-thiazole-5-carboxylic acid is O=C(O)c1cnc(N2CCN(c3nccs3)CC2)s1.
What is the InChIKey of 2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-1,3-thiazole-5-carboxylic acid?
The InChIKey is YYFKAISYCMQSLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N4O2S2/c16-9(17)8-7-13-11(19-8)15-4-2-14(3-5-15)10-12-1-6-18-10/h1,6-7H,2-5H2,(H,16,17).
What are the key properties of 2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-1,3-thiazole-5-carboxylic acid?
2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-1,3-thiazole-5-carboxylic acid has a molecular weight of 296.38 g/mol, XLogP of 1.62, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 62753297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).