C12H18F3N3OS — CID 62753564
N-cyclopropyl-5-[(2-methoxyethylamino)methyl]-N-(2,2,2-trifluoroethyl)-1,3-thiazol-2-amine (PubChem CID 62753564) has the molecular formula C12H18F3N3OS and a molecular weight of 309.36 g/mol. Its IUPAC name is N-cyclopropyl-5-[(2-methoxyethylamino)methyl]-N-(2,2,2-trifluoroethyl)-1,3-thiazol-2-amine.
| Compound Name | N-cyclopropyl-5-[(2-methoxyethylamino)methyl]-N-(2,2,2-trifluoroethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 62753564 |
| Molecular Formula | C12H18F3N3OS |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | N-cyclopropyl-5-[(2-methoxyethylamino)methyl]-N-(2,2,2-trifluoroethyl)-1,3-thiazol-2-amine |
| SMILES | COCCNCc1cnc(N(CC(F)(F)F)C2CC2)s1 |
| InChI | InChI=1S/C12H18F3N3OS/c1-19-5-4-16-6-10-7-17-11(20-10)18(9-2-3-9)8-12(13,14)15/h7,9,16H,2-6,8H2,1H3 |
| InChIKey | ZJQBMBAOBPBMKN-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|