About [2-[pentyl(propan-2-yl)amino]-1,3-thiazol-5-yl]methanol
[2-[pentyl(propan-2-yl)amino]-1,3-thiazol-5-yl]methanol (PubChem CID 62754215) has the molecular formula C12H22N2OS
and a molecular weight of 242.39 g/mol. Its IUPAC name is [2-[pentyl(propan-2-yl)amino]-1,3-thiazol-5-yl]methanol.
Molecular Properties
| Compound Name | [2-[pentyl(propan-2-yl)amino]-1,3-thiazol-5-yl]methanol |
| PubChem CID | 62754215 |
| Molecular Formula | C12H22N2OS |
| Molecular Weight | 242.39 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | [2-[pentyl(propan-2-yl)amino]-1,3-thiazol-5-yl]methanol |
| SMILES | CCCCCN(c1ncc(CO)s1)C(C)C |
| InChI | InChI=1S/C12H22N2OS/c1-4-5-6-7-14(10(2)3)12-13-8-11(9-15)16-12/h8,10,15H,4-7,9H2,1-3H3 |
| InChIKey | BRUKNEXNVQLRBO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.39 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [2-[pentyl(propan-2-yl)amino]-1,3-thiazol-5-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[pentyl(propan-2-yl)amino]-1,3-thiazol-5-yl]methanol?
The IUPAC name of [2-[pentyl(propan-2-yl)amino]-1,3-thiazol-5-yl]methanol (CID 62754215) is [2-[pentyl(propan-2-yl)amino]-1,3-thiazol-5-yl]methanol.
What is the SMILES notation for [2-[pentyl(propan-2-yl)amino]-1,3-thiazol-5-yl]methanol?
The canonical SMILES for [2-[pentyl(propan-2-yl)amino]-1,3-thiazol-5-yl]methanol is CCCCCN(c1ncc(CO)s1)C(C)C.
What is the InChIKey of [2-[pentyl(propan-2-yl)amino]-1,3-thiazol-5-yl]methanol?
The InChIKey is BRUKNEXNVQLRBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2OS/c1-4-5-6-7-14(10(2)3)12-13-8-11(9-15)16-12/h8,10,15H,4-7,9H2,1-3H3.
What are the key properties of [2-[pentyl(propan-2-yl)amino]-1,3-thiazol-5-yl]methanol?
[2-[pentyl(propan-2-yl)amino]-1,3-thiazol-5-yl]methanol has a molecular weight of 242.39 g/mol, XLogP of 3.04, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[pentyl(propan-2-yl)amino]-1,3-thiazol-5-yl]methanol is sourced from PubChem (CID 62754215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).