C12H20F3N3OS — CID 62754413
5-[(2-methoxyethylamino)methyl]-N-propan-2-yl-N-(2,2,2-trifluoroethyl)-1,3-thiazol-2-amine (PubChem CID 62754413) has the molecular formula C12H20F3N3OS and a molecular weight of 311.37 g/mol. Its IUPAC name is 5-[(2-methoxyethylamino)methyl]-N-propan-2-yl-N-(2,2,2-trifluoroethyl)-1,3-thiazol-2-amine.
| Compound Name | 5-[(2-methoxyethylamino)methyl]-N-propan-2-yl-N-(2,2,2-trifluoroethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 62754413 |
| Molecular Formula | C12H20F3N3OS |
| Molecular Weight | 311.37 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 5-[(2-methoxyethylamino)methyl]-N-propan-2-yl-N-(2,2,2-trifluoroethyl)-1,3-thiazol-2-amine |
| SMILES | COCCNCc1cnc(N(CC(F)(F)F)C(C)C)s1 |
| InChI | InChI=1S/C12H20F3N3OS/c1-9(2)18(8-12(13,14)15)11-17-7-10(20-11)6-16-4-5-19-3/h7,9,16H,4-6,8H2,1-3H3 |
| InChIKey | PCCWPBQSJUSOIY-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.37 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|