About 1-(1,1-dioxothiolan-3-yl)-N-[(1-methyltriazol-4-yl)methyl]methanamine
1-(1,1-dioxothiolan-3-yl)-N-[(1-methyltriazol-4-yl)methyl]methanamine (PubChem CID 62755802) has the molecular formula C9H16N4O2S
and a molecular weight of 244.32 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-N-[(1-methyltriazol-4-yl)methyl]methanamine.
Molecular Properties
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-N-[(1-methyltriazol-4-yl)methyl]methanamine |
| PubChem CID | 62755802 |
| Molecular Formula | C9H16N4O2S |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-N-[(1-methyltriazol-4-yl)methyl]methanamine |
| SMILES | Cn1cc(CNCC2CCS(=O)(=O)C2)nn1 |
| InChI | InChI=1S/C9H16N4O2S/c1-13-6-9(11-12-13)5-10-4-8-2-3-16(14,15)7-8/h6,8,10H,2-5,7H2,1H3 |
| InChIKey | NKNQRJQEDLIZFS-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(1,1-dioxothiolan-3-yl)-N-[(1-methyltriazol-4-yl)methyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,1-dioxothiolan-3-yl)-N-[(1-methyltriazol-4-yl)methyl]methanamine?
The IUPAC name of 1-(1,1-dioxothiolan-3-yl)-N-[(1-methyltriazol-4-yl)methyl]methanamine (CID 62755802) is 1-(1,1-dioxothiolan-3-yl)-N-[(1-methyltriazol-4-yl)methyl]methanamine.
What is the SMILES notation for 1-(1,1-dioxothiolan-3-yl)-N-[(1-methyltriazol-4-yl)methyl]methanamine?
The canonical SMILES for 1-(1,1-dioxothiolan-3-yl)-N-[(1-methyltriazol-4-yl)methyl]methanamine is Cn1cc(CNCC2CCS(=O)(=O)C2)nn1.
What is the InChIKey of 1-(1,1-dioxothiolan-3-yl)-N-[(1-methyltriazol-4-yl)methyl]methanamine?
The InChIKey is NKNQRJQEDLIZFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N4O2S/c1-13-6-9(11-12-13)5-10-4-8-2-3-16(14,15)7-8/h6,8,10H,2-5,7H2,1H3.
What are the key properties of 1-(1,1-dioxothiolan-3-yl)-N-[(1-methyltriazol-4-yl)methyl]methanamine?
1-(1,1-dioxothiolan-3-yl)-N-[(1-methyltriazol-4-yl)methyl]methanamine has a molecular weight of 244.32 g/mol, XLogP of -0.66, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,1-dioxothiolan-3-yl)-N-[(1-methyltriazol-4-yl)methyl]methanamine is sourced from PubChem (CID 62755802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).