C12H14N8 — CID 62756138
3-methyl-N-[(1-methyltriazol-4-yl)methyl]-4-(tetrazol-1-yl)aniline (PubChem CID 62756138) has the molecular formula C12H14N8 and a molecular weight of 270.30 g/mol. Its IUPAC name is 3-methyl-N-[(1-methyltriazol-4-yl)methyl]-4-(tetrazol-1-yl)aniline.
| Compound Name | 3-methyl-N-[(1-methyltriazol-4-yl)methyl]-4-(tetrazol-1-yl)aniline |
|---|---|
| PubChem CID | 62756138 |
| Molecular Formula | C12H14N8 |
| Molecular Weight | 270.30 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 3-methyl-N-[(1-methyltriazol-4-yl)methyl]-4-(tetrazol-1-yl)aniline |
| SMILES | Cc1cc(NCc2cn(C)nn2)ccc1-n1cnnn1 |
| InChI | InChI=1S/C12H14N8/c1-9-5-10(13-6-11-7-19(2)17-15-11)3-4-12(9)20-8-14-16-18-20/h3-5,7-8,13H,6H2,1-2H3 |
| InChIKey | UNWKTEHDHLXYAI-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 86.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.30 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |