About 2-[2-(furan-2-yl)-4,6-dimethylpyrimidin-5-yl]-N-(2-methoxyethyl)propan-1-amine
2-[2-(furan-2-yl)-4,6-dimethylpyrimidin-5-yl]-N-(2-methoxyethyl)propan-1-amine (PubChem CID 62757289) has the molecular formula C16H23N3O2
and a molecular weight of 289.38 g/mol. Its IUPAC name is 2-[2-(furan-2-yl)-4,6-dimethylpyrimidin-5-yl]-N-(2-methoxyethyl)propan-1-amine.
Molecular Properties
| Compound Name | 2-[2-(furan-2-yl)-4,6-dimethylpyrimidin-5-yl]-N-(2-methoxyethyl)propan-1-amine |
| PubChem CID | 62757289 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 2-[2-(furan-2-yl)-4,6-dimethylpyrimidin-5-yl]-N-(2-methoxyethyl)propan-1-amine |
| SMILES | COCCNCC(C)c1c(C)nc(-c2ccco2)nc1C |
| InChI | InChI=1S/C16H23N3O2/c1-11(10-17-7-9-20-4)15-12(2)18-16(19-13(15)3)14-6-5-8-21-14/h5-6,8,11,17H,7,9-10H2,1-4H3 |
| InChIKey | UHSSDWXIIJEFSC-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(furan-2-yl)-4,6-dimethylpyrimidin-5-yl]-N-(2-methoxyethyl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(furan-2-yl)-4,6-dimethylpyrimidin-5-yl]-N-(2-methoxyethyl)propan-1-amine?
The IUPAC name of 2-[2-(furan-2-yl)-4,6-dimethylpyrimidin-5-yl]-N-(2-methoxyethyl)propan-1-amine (CID 62757289) is 2-[2-(furan-2-yl)-4,6-dimethylpyrimidin-5-yl]-N-(2-methoxyethyl)propan-1-amine.
What is the SMILES notation for 2-[2-(furan-2-yl)-4,6-dimethylpyrimidin-5-yl]-N-(2-methoxyethyl)propan-1-amine?
The canonical SMILES for 2-[2-(furan-2-yl)-4,6-dimethylpyrimidin-5-yl]-N-(2-methoxyethyl)propan-1-amine is COCCNCC(C)c1c(C)nc(-c2ccco2)nc1C.
What is the InChIKey of 2-[2-(furan-2-yl)-4,6-dimethylpyrimidin-5-yl]-N-(2-methoxyethyl)propan-1-amine?
The InChIKey is UHSSDWXIIJEFSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N3O2/c1-11(10-17-7-9-20-4)15-12(2)18-16(19-13(15)3)14-6-5-8-21-14/h5-6,8,11,17H,7,9-10H2,1-4H3.
What are the key properties of 2-[2-(furan-2-yl)-4,6-dimethylpyrimidin-5-yl]-N-(2-methoxyethyl)propan-1-amine?
2-[2-(furan-2-yl)-4,6-dimethylpyrimidin-5-yl]-N-(2-methoxyethyl)propan-1-amine has a molecular weight of 289.38 g/mol, XLogP of 2.69, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(furan-2-yl)-4,6-dimethylpyrimidin-5-yl]-N-(2-methoxyethyl)propan-1-amine is sourced from PubChem (CID 62757289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).