C14H16N4O — CID 62758402
N-[2-methyl-4-(pyrimidin-5-ylmethylamino)phenyl]acetamide (PubChem CID 62758402) has the molecular formula C14H16N4O and a molecular weight of 256.31 g/mol. Its IUPAC name is N-[2-methyl-4-(pyrimidin-5-ylmethylamino)phenyl]acetamide.
| Compound Name | N-[2-methyl-4-(pyrimidin-5-ylmethylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 62758402 |
| Molecular Formula | C14H16N4O |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | N-[2-methyl-4-(pyrimidin-5-ylmethylamino)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(NCc2cncnc2)cc1C |
| InChI | InChI=1S/C14H16N4O/c1-10-5-13(3-4-14(10)18-11(2)19)17-8-12-6-15-9-16-7-12/h3-7,9,17H,8H2,1-2H3,(H,18,19) |
| InChIKey | ZOXMUWYVKMKHJQ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |